C25H39N3O6 — CID 178046335
N-hydroxy-6-[4-[3-[5-(2-hydroxy-3,3-dimethylbutoxy)-1,3,4-oxadiazol-2-yl]pentan-3-yl]phenoxy]hexanamide (PubChem CID 178046335) has the molecular formula C25H39N3O6 and a molecular weight of 477.60 g/mol. Its IUPAC name is N-hydroxy-6-[4-[3-[5-(2-hydroxy-3,3-dimethylbutoxy)-1,3,4-oxadiazol-2-yl]pentan-3-yl]phenoxy]hexanamide.
| Compound Name | N-hydroxy-6-[4-[3-[5-(2-hydroxy-3,3-dimethylbutoxy)-1,3,4-oxadiazol-2-yl]pentan-3-yl]phenoxy]hexanamide |
|---|---|
| PubChem CID | 178046335 |
| Molecular Formula | C25H39N3O6 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | N-hydroxy-6-[4-[3-[5-(2-hydroxy-3,3-dimethylbutoxy)-1,3,4-oxadiazol-2-yl]pentan-3-yl]phenoxy]hexanamide |
| SMILES | CCC(CC)(c1ccc(OCCCCCC(=O)NO)cc1)c1nnc(OCC(O)C(C)(C)C)o1 |
| InChI | InChI=1S/C25H39N3O6/c1-6-25(7-2,22-26-27-23(34-22)33-17-20(29)24(3,4)5)18-12-14-19(15-13-18)32-16-10-8-9-11-21(30)28-31/h12-15,20,29,31H,6-11,16-17H2,1-5H3,(H,28,30) |
| InChIKey | RFUIUFJLTJWYGV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|