C33H49NO5 — CID 157095786
N-hydroxy-8-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-8-oxooctanamide (PubChem CID 157095786) has the molecular formula C33H49NO5 and a molecular weight of 539.76 g/mol. Its IUPAC name is N-hydroxy-8-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-8-oxooctanamide.
| Compound Name | N-hydroxy-8-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-8-oxooctanamide |
|---|---|
| PubChem CID | 157095786 |
| Molecular Formula | C33H49NO5 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | N-hydroxy-8-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-8-oxooctanamide |
| SMILES | CCC(CC)(c1ccc(OCC(O)C(C)(C)C)c(C)c1)c1ccc(C(=O)CCCCCCC(=O)NO)c(C)c1 |
| InChI | InChI=1S/C33H49NO5/c1-8-33(9-2,26-17-19-29(24(4)21-26)39-22-30(36)32(5,6)7)25-16-18-27(23(3)20-25)28(35)14-12-10-11-13-15-31(37)34-38/h16-21,30,36,38H,8-15,22H2,1-7H3,(H,34,37) |
| InChIKey | AFERTKVRWMFWHV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|