C25H29F2NO5 — CID 70247952
3-[4-[(2,6-difluorophenyl)methoxy]-3-[3-(oxan-2-yloxy)propoxy]phenyl]but-2-enamide (PubChem CID 70247952) has the molecular formula C25H29F2NO5 and a molecular weight of 461.51 g/mol. Its IUPAC name is 3-[4-[(2,6-difluorophenyl)methoxy]-3-[3-(oxan-2-yloxy)propoxy]phenyl]but-2-enamide.
| Compound Name | 3-[4-[(2,6-difluorophenyl)methoxy]-3-[3-(oxan-2-yloxy)propoxy]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 70247952 |
| Molecular Formula | C25H29F2NO5 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-[4-[(2,6-difluorophenyl)methoxy]-3-[3-(oxan-2-yloxy)propoxy]phenyl]but-2-enamide |
| SMILES | CC(=CC(N)=O)c1ccc(OCc2c(F)cccc2F)c(OCCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C25H29F2NO5/c1-17(14-24(28)29)18-9-10-22(33-16-19-20(26)6-4-7-21(19)27)23(15-18)30-12-5-13-32-25-8-2-3-11-31-25/h4,6-7,9-10,14-15,25H,2-3,5,8,11-13,16H2,1H3,(H2,28,29) |
| InChIKey | SOFQHGIZLYIEBD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|