C23H24F2O3 — CID 59303190
(E)-1-(2,5-difluorophenyl)-6-(oxan-2-yloxy)-3-phenylhex-2-en-1-one (PubChem CID 59303190) has the molecular formula C23H24F2O3 and a molecular weight of 386.44 g/mol. Its IUPAC name is (E)-1-(2,5-difluorophenyl)-6-(oxan-2-yloxy)-3-phenylhex-2-en-1-one.
| Compound Name | (E)-1-(2,5-difluorophenyl)-6-(oxan-2-yloxy)-3-phenylhex-2-en-1-one |
|---|---|
| PubChem CID | 59303190 |
| Molecular Formula | C23H24F2O3 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (E)-1-(2,5-difluorophenyl)-6-(oxan-2-yloxy)-3-phenylhex-2-en-1-one |
| SMILES | O=C(/C=C(\CCCOC1CCCCO1)c1ccccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C23H24F2O3/c24-19-11-12-21(25)20(16-19)22(26)15-18(17-7-2-1-3-8-17)9-6-14-28-23-10-4-5-13-27-23/h1-3,7-8,11-12,15-16,23H,4-6,9-10,13-14H2/b18-15+ |
| InChIKey | FGJXKKCXHNTUKU-OBGWFSINSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|