C24H25FN2O7 — CID 123631011
[2-fluoro-3-[6-methoxy-7-[2-(oxan-2-yloxy)ethoxy]quinazolin-4-yl]oxyphenyl] acetate (PubChem CID 123631011) has the molecular formula C24H25FN2O7 and a molecular weight of 472.47 g/mol. Its IUPAC name is [2-fluoro-3-[6-methoxy-7-[2-(oxan-2-yloxy)ethoxy]quinazolin-4-yl]oxyphenyl] acetate.
| Compound Name | [2-fluoro-3-[6-methoxy-7-[2-(oxan-2-yloxy)ethoxy]quinazolin-4-yl]oxyphenyl] acetate |
|---|---|
| PubChem CID | 123631011 |
| Molecular Formula | C24H25FN2O7 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [2-fluoro-3-[6-methoxy-7-[2-(oxan-2-yloxy)ethoxy]quinazolin-4-yl]oxyphenyl] acetate |
| SMILES | COc1cc2c(Oc3cccc(OC(C)=O)c3F)ncnc2cc1OCCOC1CCCCO1 |
| InChI | InChI=1S/C24H25FN2O7/c1-15(28)33-18-6-5-7-19(23(18)25)34-24-16-12-20(29-2)21(13-17(16)26-14-27-24)30-10-11-32-22-8-3-4-9-31-22/h5-7,12-14,22H,3-4,8-11H2,1-2H3 |
| InChIKey | DDTRQZVVAOSIDF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|