C23H23F3N2O4Si — CID 142555243
2-[3-[6-[2-(difluoromethoxy)ethoxy]-7-methoxyquinazolin-4-yl]oxy-2-fluorophenyl]ethynyl-trimethylsilane (PubChem CID 142555243) has the molecular formula C23H23F3N2O4Si and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-[3-[6-[2-(difluoromethoxy)ethoxy]-7-methoxyquinazolin-4-yl]oxy-2-fluorophenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[3-[6-[2-(difluoromethoxy)ethoxy]-7-methoxyquinazolin-4-yl]oxy-2-fluorophenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 142555243 |
| Molecular Formula | C23H23F3N2O4Si |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[3-[6-[2-(difluoromethoxy)ethoxy]-7-methoxyquinazolin-4-yl]oxy-2-fluorophenyl]ethynyl-trimethylsilane |
| SMILES | COc1cc2ncnc(Oc3cccc(C#C[Si](C)(C)C)c3F)c2cc1OCCOC(F)F |
| InChI | InChI=1S/C23H23F3N2O4Si/c1-29-19-13-17-16(12-20(19)30-9-10-31-23(25)26)22(28-14-27-17)32-18-7-5-6-15(21(18)24)8-11-33(2,3)4/h5-7,12-14,23H,9-10H2,1-4H3 |
| InChIKey | KHYBYXSJDOWJHQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|