C22H23FN2O7 — CID 66907480
2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-3-fluorophenyl]acetic acid (PubChem CID 66907480) has the molecular formula C22H23FN2O7 and a molecular weight of 446.43 g/mol. Its IUPAC name is 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-3-fluorophenyl]acetic acid.
| Compound Name | 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-3-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 66907480 |
| Molecular Formula | C22H23FN2O7 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-3-fluorophenyl]acetic acid |
| SMILES | COCCOc1cc2ncnc(Oc3ccc(CC(=O)O)cc3F)c2cc1OCCOC |
| InChI | InChI=1S/C22H23FN2O7/c1-28-5-7-30-19-11-15-17(12-20(19)31-8-6-29-2)24-13-25-22(15)32-18-4-3-14(9-16(18)23)10-21(26)27/h3-4,9,11-13H,5-8,10H2,1-2H3,(H,26,27) |
| InChIKey | RKHXYMHUUDDQQP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|