C36H38N4O7 — CID 158942229
3-[2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-3-methylphenyl]acetyl]-1-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-one (PubChem CID 158942229) has the molecular formula C36H38N4O7 and a molecular weight of 638.72 g/mol. Its IUPAC name is 3-[2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-3-methylphenyl]acetyl]-1-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-one.
| Compound Name | 3-[2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-3-methylphenyl]acetyl]-1-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-one |
|---|---|
| PubChem CID | 158942229 |
| Molecular Formula | C36H38N4O7 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | 3-[2-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-3-methylphenyl]acetyl]-1-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-one |
| SMILES | COCCOc1cc2ncnc(Oc3ccc(CC(=O)c4c5n(n(-c6ccccc6)c4=O)CCCC5)cc3C)c2cc1OCCOC |
| InChI | InChI=1S/C36H38N4O7/c1-24-19-25(20-30(41)34-29-11-7-8-14-39(29)40(36(34)42)26-9-5-4-6-10-26)12-13-31(24)47-35-27-21-32(45-17-15-43-2)33(46-18-16-44-3)22-28(27)37-23-38-35/h4-6,9-10,12-13,19,21-23H,7-8,11,14-18,20H2,1-3H3 |
| InChIKey | JKJVUPZDDFSBFE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 115.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|