C18H15ClN2O4 — CID 86238128
2-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]acetyl chloride (PubChem CID 86238128) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is 2-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]acetyl chloride.
| Compound Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]acetyl chloride |
|---|---|
| PubChem CID | 86238128 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]acetyl chloride |
| SMILES | COc1cc2ncnc(Oc3ccc(CC(=O)Cl)cc3)c2cc1OC |
| InChI | InChI=1S/C18H15ClN2O4/c1-23-15-8-13-14(9-16(15)24-2)20-10-21-18(13)25-12-5-3-11(4-6-12)7-17(19)22/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | LUIYDQKATIXBFV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|