C25H21N3O6 — CID 155671308
2-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-N-(4-methoxyphenyl)-2-oxoacetamide (PubChem CID 155671308) has the molecular formula C25H21N3O6 and a molecular weight of 459.46 g/mol. Its IUPAC name is 2-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-N-(4-methoxyphenyl)-2-oxoacetamide.
| Compound Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-N-(4-methoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 155671308 |
| Molecular Formula | C25H21N3O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-N-(4-methoxyphenyl)-2-oxoacetamide |
| SMILES | COc1ccc(NC(=O)C(=O)c2ccc(Oc3ncnc4cc(OC)c(OC)cc34)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O6/c1-31-17-10-6-16(7-11-17)28-24(30)23(29)15-4-8-18(9-5-15)34-25-19-12-21(32-2)22(33-3)13-20(19)26-14-27-25/h4-14H,1-3H3,(H,28,30) |
| InChIKey | VWHJJGQUYIHINW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|