C24H22N4O5 — CID 22667241
1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(2-methoxyphenyl)urea (PubChem CID 22667241) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 22667241 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1ccc(Oc2ncnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C24H22N4O5/c1-30-20-7-5-4-6-18(20)28-24(29)27-15-8-10-16(11-9-15)33-23-17-12-21(31-2)22(32-3)13-19(17)25-14-26-23/h4-14H,1-3H3,(H2,27,28,29) |
| InChIKey | USEMMOPEUFKDIL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |