C20H17N5O4S — CID 21092461
1-[2-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 21092461) has the molecular formula C20H17N5O4S and a molecular weight of 423.45 g/mol. Its IUPAC name is 1-[2-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 21092461 |
| Molecular Formula | C20H17N5O4S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 1-[2-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | COc1cc2ncnc(Oc3ccccc3NC(=O)Nc3nccs3)c2cc1OC |
| InChI | InChI=1S/C20H17N5O4S/c1-27-16-9-12-14(10-17(16)28-2)22-11-23-18(12)29-15-6-4-3-5-13(15)24-19(26)25-20-21-7-8-30-20/h3-11H,1-2H3,(H2,21,24,25,26) |
| InChIKey | KSXCJALQOUHDOK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |