C23H20N4O4 — CID 67202836
1-[2-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-pyridin-3-ylurea (PubChem CID 67202836) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-[2-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[2-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 67202836 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 1-[2-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-pyridin-3-ylurea |
| SMILES | COc1cc2nccc(Oc3ccccc3NC(=O)Nc3cccnc3)c2cc1OC |
| InChI | InChI=1S/C23H20N4O4/c1-29-21-12-16-18(13-22(21)30-2)25-11-9-19(16)31-20-8-4-3-7-17(20)27-23(28)26-15-6-5-10-24-14-15/h3-14H,1-2H3,(H2,26,27,28) |
| InChIKey | VJXVFZOHYCXIQU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |