C17H12N4O2S — CID 59732941
1-[2-(4-cyanophenoxy)phenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 59732941) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 1-[2-(4-cyanophenoxy)phenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-(4-cyanophenoxy)phenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 59732941 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-[2-(4-cyanophenoxy)phenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | N#Cc1ccc(Oc2ccccc2NC(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C17H12N4O2S/c18-11-12-5-7-13(8-6-12)23-15-4-2-1-3-14(15)20-16(22)21-17-19-9-10-24-17/h1-10H,(H2,19,20,21,22) |
| InChIKey | UMDJRMWXZHKBEP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |