C12H13N3O3S — CID 108867903
1-(2,6-dimethoxyphenyl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 108867903) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-(2,6-dimethoxyphenyl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 108867903 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | COc1cccc(OC)c1NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H13N3O3S/c1-17-8-4-3-5-9(18-2)10(8)14-11(16)15-12-13-6-7-19-12/h3-7H,1-2H3,(H2,13,14,15,16) |
| InChIKey | VBDGGCYHBKUWAN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |