C6H10N3O4PS — CID 4904044
1-dimethoxyphosphoryl-3-(1,3-thiazol-2-yl)urea (PubChem CID 4904044) has the molecular formula C6H10N3O4PS and a molecular weight of 251.20 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-dimethoxyphosphoryl-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 4904044 |
| Molecular Formula | C6H10N3O4PS |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 1-dimethoxyphosphoryl-3-(1,3-thiazol-2-yl)urea |
| SMILES | COP(=O)(NC(=O)Nc1nccs1)OC |
| InChI | InChI=1S/C6H10N3O4PS/c1-12-14(11,13-2)9-5(10)8-6-7-3-4-15-6/h3-4H,1-2H3,(H2,7,8,9,10,11) |
| InChIKey | PBOJWFSNVMUDSS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|