C19H19N3O5S — CID 59732942
1-[2-(2,3-dimethoxyphenoxy)-5-methoxyphenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 59732942) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is 1-[2-(2,3-dimethoxyphenoxy)-5-methoxyphenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-(2,3-dimethoxyphenoxy)-5-methoxyphenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 59732942 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-[2-(2,3-dimethoxyphenoxy)-5-methoxyphenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | COc1ccc(Oc2cccc(OC)c2OC)c(NC(=O)Nc2nccs2)c1 |
| InChI | InChI=1S/C19H19N3O5S/c1-24-12-7-8-14(27-16-6-4-5-15(25-2)17(16)26-3)13(11-12)21-18(23)22-19-20-9-10-28-19/h4-11H,1-3H3,(H2,20,21,22,23) |
| InChIKey | LLMCTPHQYJWPDE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |