C18H15FN4O3S — CID 59732796
2-[4-fluoro-2-(1,3-thiazol-2-ylcarbamoylamino)phenoxy]-N-methylbenzamide (PubChem CID 59732796) has the molecular formula C18H15FN4O3S and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-[4-fluoro-2-(1,3-thiazol-2-ylcarbamoylamino)phenoxy]-N-methylbenzamide.
| Compound Name | 2-[4-fluoro-2-(1,3-thiazol-2-ylcarbamoylamino)phenoxy]-N-methylbenzamide |
|---|---|
| PubChem CID | 59732796 |
| Molecular Formula | C18H15FN4O3S |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[4-fluoro-2-(1,3-thiazol-2-ylcarbamoylamino)phenoxy]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Oc1ccc(F)cc1NC(=O)Nc1nccs1 |
| InChI | InChI=1S/C18H15FN4O3S/c1-20-16(24)12-4-2-3-5-14(12)26-15-7-6-11(19)10-13(15)22-17(25)23-18-21-8-9-27-18/h2-10H,1H3,(H,20,24)(H2,21,22,23,25) |
| InChIKey | MTWXABRWJNZJNO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |