C19H19N3O4S — CID 59725734
1-[2-[(3,4-dimethoxyphenyl)methoxy]phenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 59725734) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 1-[2-[(3,4-dimethoxyphenyl)methoxy]phenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-[(3,4-dimethoxyphenyl)methoxy]phenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 59725734 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 1-[2-[(3,4-dimethoxyphenyl)methoxy]phenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | COc1ccc(COc2ccccc2NC(=O)Nc2nccs2)cc1OC |
| InChI | InChI=1S/C19H19N3O4S/c1-24-16-8-7-13(11-17(16)25-2)12-26-15-6-4-3-5-14(15)21-18(23)22-19-20-9-10-27-19/h3-11H,12H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | TWQYKNHZYYUFSK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |