C17H19NO6 — CID 3325255
(2,6-dimethoxyphenyl) N-(2,5-dimethoxyphenyl)carbamate (PubChem CID 3325255) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) N-(2,5-dimethoxyphenyl)carbamate.
| Compound Name | (2,6-dimethoxyphenyl) N-(2,5-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 3325255 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2,6-dimethoxyphenyl) N-(2,5-dimethoxyphenyl)carbamate |
| SMILES | COc1ccc(OC)c(NC(=O)Oc2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C17H19NO6/c1-20-11-8-9-13(21-2)12(10-11)18-17(19)24-16-14(22-3)6-5-7-15(16)23-4/h5-10H,1-4H3,(H,18,19) |
| InChIKey | KJIHLBKPZLIGRZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |