C14H17N3O2S — CID 51944210
1-[(1R)-1-(2-methoxyphenyl)propyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 51944210) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-[(1R)-1-(2-methoxyphenyl)propyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(1R)-1-(2-methoxyphenyl)propyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 51944210 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[(1R)-1-(2-methoxyphenyl)propyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | CC[C@@H](NC(=O)Nc1nccs1)c1ccccc1OC |
| InChI | InChI=1S/C14H17N3O2S/c1-3-11(10-6-4-5-7-12(10)19-2)16-13(18)17-14-15-8-9-20-14/h4-9,11H,3H2,1-2H3,(H2,15,16,17,18)/t11-/m1/s1 |
| InChIKey | UJCKTTSBOQMLDD-LLVKDONJSA-N |
| XLogP | 3.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |