C18H24N4O2S — CID 41394791
(2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 41394791) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is (2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | (2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 41394791 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CC[C@@H](C(=O)Nc1nccs1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c1-3-14(17(23)20-18-19-8-13-25-18)21-9-11-22(12-10-21)15-6-4-5-7-16(15)24-2/h4-8,13-14H,3,9-12H2,1-2H3,(H,19,20,23)/t14-/m0/s1 |
| InChIKey | VTZHAHVHWLYSLP-AWEZNQCLSA-N |
| XLogP | 2.69 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |