C20H13N5O2S — CID 141052131
1-[4-(6-cyanoquinolin-4-yl)oxyphenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 141052131) has the molecular formula C20H13N5O2S and a molecular weight of 387.42 g/mol. Its IUPAC name is 1-[4-(6-cyanoquinolin-4-yl)oxyphenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[4-(6-cyanoquinolin-4-yl)oxyphenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 141052131 |
| Molecular Formula | C20H13N5O2S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-[4-(6-cyanoquinolin-4-yl)oxyphenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | N#Cc1ccc2nccc(Oc3ccc(NC(=O)Nc4nccs4)cc3)c2c1 |
| InChI | InChI=1S/C20H13N5O2S/c21-12-13-1-6-17-16(11-13)18(7-8-22-17)27-15-4-2-14(3-5-15)24-19(26)25-20-23-9-10-28-20/h1-11H,(H2,23,24,25,26) |
| InChIKey | UASYOFLXWNEHHU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |