C16H15N3O6S — CID 154966615
[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl] sulfamate (PubChem CID 154966615) has the molecular formula C16H15N3O6S and a molecular weight of 377.38 g/mol. Its IUPAC name is [4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl] sulfamate.
| Compound Name | [4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl] sulfamate |
|---|---|
| PubChem CID | 154966615 |
| Molecular Formula | C16H15N3O6S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl] sulfamate |
| SMILES | COc1cc2ncnc(Oc3ccc(OS(N)(=O)=O)cc3)c2cc1OC |
| InChI | InChI=1S/C16H15N3O6S/c1-22-14-7-12-13(8-15(14)23-2)18-9-19-16(12)24-10-3-5-11(6-4-10)25-26(17,20)21/h3-9H,1-2H3,(H2,17,20,21) |
| InChIKey | HDEZVMJUEUBYOW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 122.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |