C23H22ClF3N4O4 — CID 130205675
(E)-N-[4-(3-chloro-2-fluorophenoxy)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 130205675) has the molecular formula C23H22ClF3N4O4 and a molecular weight of 510.90 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-2-fluorophenoxy)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-2-fluorophenoxy)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 130205675 |
| Molecular Formula | C23H22ClF3N4O4 |
| Molecular Weight | 510.90 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (E)-N-[4-(3-chloro-2-fluorophenoxy)-7-[2-(difluoromethoxy)ethoxy]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Oc3cccc(Cl)c3F)ncnc2cc1OCCOC(F)F |
| InChI | InChI=1S/C23H22ClF3N4O4/c1-31(2)8-4-7-20(32)30-17-11-14-16(12-19(17)33-9-10-34-23(26)27)28-13-29-22(14)35-18-6-3-5-15(24)21(18)25/h3-7,11-13,23H,8-10H2,1-2H3,(H,30,32)/b7-4+ |
| InChIKey | ISLGYGZBXJDBJW-QPJJXVBHSA-N |
| XLogP | 4.89 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|