C20H18Cl2FN5O — CID 156889676
(E)-N-[5-chloro-4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 156889676) has the molecular formula C20H18Cl2FN5O and a molecular weight of 434.30 g/mol. Its IUPAC name is (E)-N-[5-chloro-4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[5-chloro-4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 156889676 |
| Molecular Formula | C20H18Cl2FN5O |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (E)-N-[5-chloro-4-(3-chloro-2-fluoroanilino)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccc2ncnc(Nc3cccc(Cl)c3F)c2c1Cl |
| InChI | InChI=1S/C20H18Cl2FN5O/c1-28(2)10-4-7-16(29)26-14-9-8-13-17(18(14)22)20(25-11-24-13)27-15-6-3-5-12(21)19(15)23/h3-9,11H,10H2,1-2H3,(H,26,29)(H,24,25,27)/b7-4+ |
| InChIKey | BVZHGGKNSBZCTH-QPJJXVBHSA-N |
| XLogP | 4.88 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|