C21H21ClFN7O — CID 66769530
N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]-2-pyridinyl]-4-(dimethylamino)but-2-enamide (PubChem CID 66769530) has the molecular formula C21H21ClFN7O and a molecular weight of 441.90 g/mol. Its IUPAC name is N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]-2-pyridinyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]-2-pyridinyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 66769530 |
| Molecular Formula | C21H21ClFN7O |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]-2-pyridinyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)CC=CC(=O)Nc1ncccc1Nc1cc(Nc2ccc(F)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C21H21ClFN7O/c1-30(2)10-4-6-20(31)29-21-17(5-3-9-24-21)28-19-12-18(25-13-26-19)27-14-7-8-16(23)15(22)11-14/h3-9,11-13H,10H2,1-2H3,(H,24,29,31)(H2,25,26,27,28) |
| InChIKey | QHMJPWXBCYQYLW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|