C19H20F2N4O3 — CID 168943068
3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinazolin-4-yl]oxy-N-methylaniline (PubChem CID 168943068) has the molecular formula C19H20F2N4O3 and a molecular weight of 390.39 g/mol. Its IUPAC name is 3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinazolin-4-yl]oxy-N-methylaniline.
| Compound Name | 3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinazolin-4-yl]oxy-N-methylaniline |
|---|---|
| PubChem CID | 168943068 |
| Molecular Formula | C19H20F2N4O3 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinazolin-4-yl]oxy-N-methylaniline |
| SMILES | CNCCOc1cc2ncnc(Oc3c(F)cc(NC)cc3F)c2cc1OC |
| InChI | InChI=1S/C19H20F2N4O3/c1-22-4-5-27-17-9-15-12(8-16(17)26-3)19(25-10-24-15)28-18-13(20)6-11(23-2)7-14(18)21/h6-10,22-23H,4-5H2,1-3H3 |
| InChIKey | HJPOXIJKISOQRO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|