C30H32F2N4O5 — CID 168943048
4-cyclobutyloxypyridine-3-carbaldehyde;3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline (PubChem CID 168943048) has the molecular formula C30H32F2N4O5 and a molecular weight of 566.61 g/mol. Its IUPAC name is 4-cyclobutyloxypyridine-3-carbaldehyde;3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline.
| Compound Name | 4-cyclobutyloxypyridine-3-carbaldehyde;3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline |
|---|---|
| PubChem CID | 168943048 |
| Molecular Formula | C30H32F2N4O5 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 4-cyclobutyloxypyridine-3-carbaldehyde;3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline |
| SMILES | CNCCOc1cc2nccc(Oc3c(F)cc(NC)cc3F)c2cc1OC.O=Cc1cnccc1OC1CCC1 |
| InChI | InChI=1S/C20H21F2N3O3.C10H11NO2/c1-23-6-7-27-19-11-16-13(10-18(19)26-3)17(4-5-25-16)28-20-14(21)8-12(24-2)9-15(20)22;12-7-8-6-11-5-4-10(8)13-9-2-1-3-9/h4-5,8-11,23-24H,6-7H2,1-3H3;4-7,9H,1-3H2 |
| InChIKey | KJMAVUBUVXVZFQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|