C28H26F2N4O5 — CID 168842926
2-cyclopropyloxy-N-[3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyphenyl]pyridine-3-carboxamide (PubChem CID 168842926) has the molecular formula C28H26F2N4O5 and a molecular weight of 536.54 g/mol. Its IUPAC name is 2-cyclopropyloxy-N-[3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyphenyl]pyridine-3-carboxamide.
| Compound Name | 2-cyclopropyloxy-N-[3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168842926 |
| Molecular Formula | C28H26F2N4O5 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-cyclopropyloxy-N-[3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyphenyl]pyridine-3-carboxamide |
| SMILES | CNCCOc1cc2nccc(Oc3c(F)cc(NC(=O)c4cccnc4OC4CC4)cc3F)c2cc1OC |
| InChI | InChI=1S/C28H26F2N4O5/c1-31-10-11-37-25-15-22-19(14-24(25)36-2)23(7-9-32-22)39-26-20(29)12-16(13-21(26)30)34-27(35)18-4-3-8-33-28(18)38-17-5-6-17/h3-4,7-9,12-15,17,31H,5-6,10-11H2,1-2H3,(H,34,35) |
| InChIKey | ZWSZREHFHHDAKK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|