C28H28F2N4O5 — CID 169045756
N-[3,5-difluoro-4-[6-(hydroxymethyl)-7-[3-(methylamino)propoxy]quinolin-4-yl]oxyphenyl]-4-ethoxypyridine-3-carboxamide (PubChem CID 169045756) has the molecular formula C28H28F2N4O5 and a molecular weight of 538.55 g/mol. Its IUPAC name is N-[3,5-difluoro-4-[6-(hydroxymethyl)-7-[3-(methylamino)propoxy]quinolin-4-yl]oxyphenyl]-4-ethoxypyridine-3-carboxamide.
| Compound Name | N-[3,5-difluoro-4-[6-(hydroxymethyl)-7-[3-(methylamino)propoxy]quinolin-4-yl]oxyphenyl]-4-ethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 169045756 |
| Molecular Formula | C28H28F2N4O5 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | N-[3,5-difluoro-4-[6-(hydroxymethyl)-7-[3-(methylamino)propoxy]quinolin-4-yl]oxyphenyl]-4-ethoxypyridine-3-carboxamide |
| SMILES | CCOc1ccncc1C(=O)Nc1cc(F)c(Oc2ccnc3cc(OCCCNC)c(CO)cc23)c(F)c1 |
| InChI | InChI=1S/C28H28F2N4O5/c1-3-37-24-5-8-32-15-20(24)28(36)34-18-12-21(29)27(22(30)13-18)39-25-6-9-33-23-14-26(38-10-4-7-31-2)17(16-35)11-19(23)25/h5-6,8-9,11-15,31,35H,3-4,7,10,16H2,1-2H3,(H,34,36) |
| InChIKey | LNQIAZIBLNDTPQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|