C15H15FN2O3 — CID 64950704
N-[4-ethoxy-3-(hydroxymethyl)phenyl]-3-fluoropyridine-4-carboxamide (PubChem CID 64950704) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is N-[4-ethoxy-3-(hydroxymethyl)phenyl]-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 64950704 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-3-fluoropyridine-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccncc2F)cc1CO |
| InChI | InChI=1S/C15H15FN2O3/c1-2-21-14-4-3-11(7-10(14)9-19)18-15(20)12-5-6-17-8-13(12)16/h3-8,19H,2,9H2,1H3,(H,18,20) |
| InChIKey | OSCRGNDQRGAWDR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |