C13H14N2O3S — CID 103868856
N-[4-ethoxy-3-(hydroxymethyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 103868856) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-[4-ethoxy-3-(hydroxymethyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 103868856 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cncs2)cc1CO |
| InChI | InChI=1S/C13H14N2O3S/c1-2-18-11-4-3-10(5-9(11)7-16)15-13(17)12-6-14-8-19-12/h3-6,8,16H,2,7H2,1H3,(H,15,17) |
| InChIKey | IMYVEZYZJSGLOW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |