C14H14INO3S — CID 79693780
N-[4-ethoxy-3-(hydroxymethyl)phenyl]-5-iodothiophene-3-carboxamide (PubChem CID 79693780) has the molecular formula C14H14INO3S and a molecular weight of 403.24 g/mol. Its IUPAC name is N-[4-ethoxy-3-(hydroxymethyl)phenyl]-5-iodothiophene-3-carboxamide.
| Compound Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79693780 |
| Molecular Formula | C14H14INO3S |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 402.97 |
| IUPAC Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-5-iodothiophene-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2csc(I)c2)cc1CO |
| InChI | InChI=1S/C14H14INO3S/c1-2-19-12-4-3-11(5-9(12)7-17)16-14(18)10-6-13(15)20-8-10/h3-6,8,17H,2,7H2,1H3,(H,16,18) |
| InChIKey | WAGOBXLDNAIGRT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|