C22H15F3N4O3 — CID 176567513
N-[4-(6-amino-7-fluoroquinolin-4-yl)oxy-3,5-difluorophenyl]-4-methoxypyridine-3-carboxamide (PubChem CID 176567513) has the molecular formula C22H15F3N4O3 and a molecular weight of 440.38 g/mol. Its IUPAC name is N-[4-(6-amino-7-fluoroquinolin-4-yl)oxy-3,5-difluorophenyl]-4-methoxypyridine-3-carboxamide.
| Compound Name | N-[4-(6-amino-7-fluoroquinolin-4-yl)oxy-3,5-difluorophenyl]-4-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 176567513 |
| Molecular Formula | C22H15F3N4O3 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[4-(6-amino-7-fluoroquinolin-4-yl)oxy-3,5-difluorophenyl]-4-methoxypyridine-3-carboxamide |
| SMILES | COc1ccncc1C(=O)Nc1cc(F)c(Oc2ccnc3cc(F)c(N)cc23)c(F)c1 |
| InChI | InChI=1S/C22H15F3N4O3/c1-31-19-2-4-27-10-13(19)22(30)29-11-6-15(24)21(16(25)7-11)32-20-3-5-28-18-9-14(23)17(26)8-12(18)20/h2-10H,26H2,1H3,(H,29,30) |
| InChIKey | IGMFHTSGFTWWOW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|