C22H15ClF2N4O4 — CID 176567509
N-[4-[(7-chloro-5-methoxy-1,6-naphthyridin-4-yl)oxy]-3,5-difluorophenyl]-4-methoxypyridine-3-carboxamide (PubChem CID 176567509) has the molecular formula C22H15ClF2N4O4 and a molecular weight of 472.84 g/mol. Its IUPAC name is N-[4-[(7-chloro-5-methoxy-1,6-naphthyridin-4-yl)oxy]-3,5-difluorophenyl]-4-methoxypyridine-3-carboxamide.
| Compound Name | N-[4-[(7-chloro-5-methoxy-1,6-naphthyridin-4-yl)oxy]-3,5-difluorophenyl]-4-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 176567509 |
| Molecular Formula | C22H15ClF2N4O4 |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | N-[4-[(7-chloro-5-methoxy-1,6-naphthyridin-4-yl)oxy]-3,5-difluorophenyl]-4-methoxypyridine-3-carboxamide |
| SMILES | COc1ccncc1C(=O)Nc1cc(F)c(Oc2ccnc3cc(Cl)nc(OC)c23)c(F)c1 |
| InChI | InChI=1S/C22H15ClF2N4O4/c1-31-16-3-5-26-10-12(16)21(30)28-11-7-13(24)20(14(25)8-11)33-17-4-6-27-15-9-18(23)29-22(32-2)19(15)17/h3-10H,1-2H3,(H,28,30) |
| InChIKey | KJSJIZPQQKUQOQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|