C30H30F2N4O5 — CID 168842787
4-cyclobutyloxy-N-[3,5-difluoro-4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxyphenyl]pyridine-3-carboxamide (PubChem CID 168842787) has the molecular formula C30H30F2N4O5 and a molecular weight of 564.59 g/mol. Its IUPAC name is 4-cyclobutyloxy-N-[3,5-difluoro-4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxyphenyl]pyridine-3-carboxamide.
| Compound Name | 4-cyclobutyloxy-N-[3,5-difluoro-4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168842787 |
| Molecular Formula | C30H30F2N4O5 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 4-cyclobutyloxy-N-[3,5-difluoro-4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxyphenyl]pyridine-3-carboxamide |
| SMILES | CNCCCOc1cc2nccc(Oc3c(F)cc(NC(=O)c4cnccc4OC4CCC4)cc3F)c2cc1OC |
| InChI | InChI=1S/C30H30F2N4O5/c1-33-9-4-12-39-28-16-24-20(15-27(28)38-2)25(8-11-35-24)41-29-22(31)13-18(14-23(29)32)36-30(37)21-17-34-10-7-26(21)40-19-5-3-6-19/h7-8,10-11,13-17,19,33H,3-6,9,12H2,1-2H3,(H,36,37) |
| InChIKey | AMRSLYRNCWASQO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|