C27H31N4O5P3 — CID 170005616
4-methoxy-N-[4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxy-3,5-bis(phosphanyl)phenyl]-2-phosphanylpyridine-3-carboxamide (PubChem CID 170005616) has the molecular formula C27H31N4O5P3 and a molecular weight of 584.49 g/mol. Its IUPAC name is 4-methoxy-N-[4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxy-3,5-bis(phosphanyl)phenyl]-2-phosphanylpyridine-3-carboxamide.
| Compound Name | 4-methoxy-N-[4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxy-3,5-bis(phosphanyl)phenyl]-2-phosphanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 170005616 |
| Molecular Formula | C27H31N4O5P3 |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 584.15 |
| IUPAC Name | 4-methoxy-N-[4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxy-3,5-bis(phosphanyl)phenyl]-2-phosphanylpyridine-3-carboxamide |
| SMILES | CNCCCOc1cc2nccc(Oc3c(P)cc(NC(=O)c4c(OC)ccnc4P)cc3P)c2cc1OC |
| InChI | InChI=1S/C27H31N4O5P3/c1-28-7-4-10-35-21-14-17-16(13-20(21)34-3)18(5-8-29-17)36-25-22(37)11-15(12-23(25)38)31-26(32)24-19(33-2)6-9-30-27(24)39/h5-6,8-9,11-14,28H,4,7,10,37-39H2,1-3H3,(H,31,32) |
| InChIKey | YWDYOJPZTOYEQV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|