C21H23F2N3O3 — CID 168943078
2,3-difluoro-4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxy-N-methylaniline (PubChem CID 168943078) has the molecular formula C21H23F2N3O3 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2,3-difluoro-4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxy-N-methylaniline.
| Compound Name | 2,3-difluoro-4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxy-N-methylaniline |
|---|---|
| PubChem CID | 168943078 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2,3-difluoro-4-[6-methoxy-7-[3-(methylamino)propoxy]quinolin-4-yl]oxy-N-methylaniline |
| SMILES | CNCCCOc1cc2nccc(Oc3ccc(NC)c(F)c3F)c2cc1OC |
| InChI | InChI=1S/C21H23F2N3O3/c1-24-8-4-10-28-19-12-15-13(11-18(19)27-3)16(7-9-26-15)29-17-6-5-14(25-2)20(22)21(17)23/h5-7,9,11-12,24-25H,4,8,10H2,1-3H3 |
| InChIKey | JOPNVDLPNOTSKP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|