C19H18F3N3O2 — CID 168943032
2,3,5-trifluoro-N-methyl-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyaniline (PubChem CID 168943032) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 2,3,5-trifluoro-N-methyl-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyaniline.
| Compound Name | 2,3,5-trifluoro-N-methyl-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 168943032 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2,3,5-trifluoro-N-methyl-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyaniline |
| SMILES | CNCCOc1ccc2c(Oc3c(F)cc(NC)c(F)c3F)ccnc2c1 |
| InChI | InChI=1S/C19H18F3N3O2/c1-23-7-8-26-11-3-4-12-14(9-11)25-6-5-16(12)27-19-13(20)10-15(24-2)17(21)18(19)22/h3-6,9-10,23-24H,7-8H2,1-2H3 |
| InChIKey | VBIHRBHXSPRSPI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|