C26H25F3N4O4 — CID 168943021
4-[7-[(2R)-2-aminopropoxy]quinolin-4-yl]oxy-3,5-difluoro-N-methylaniline;2-fluoro-4-methoxypyridine-3-carbaldehyde (PubChem CID 168943021) has the molecular formula C26H25F3N4O4 and a molecular weight of 514.50 g/mol. Its IUPAC name is 4-[7-[(2R)-2-aminopropoxy]quinolin-4-yl]oxy-3,5-difluoro-N-methylaniline;2-fluoro-4-methoxypyridine-3-carbaldehyde.
| Compound Name | 4-[7-[(2R)-2-aminopropoxy]quinolin-4-yl]oxy-3,5-difluoro-N-methylaniline;2-fluoro-4-methoxypyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 168943021 |
| Molecular Formula | C26H25F3N4O4 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 4-[7-[(2R)-2-aminopropoxy]quinolin-4-yl]oxy-3,5-difluoro-N-methylaniline;2-fluoro-4-methoxypyridine-3-carbaldehyde |
| SMILES | CNc1cc(F)c(Oc2ccnc3cc(OC[C@@H](C)N)ccc23)c(F)c1.COc1ccnc(F)c1C=O |
| InChI | InChI=1S/C19H19F2N3O2.C7H6FNO2/c1-11(22)10-25-13-3-4-14-17(9-13)24-6-5-18(14)26-19-15(20)7-12(23-2)8-16(19)21;1-11-6-2-3-9-7(8)5(6)4-10/h3-9,11,23H,10,22H2,1-2H3;2-4H,1H3/t11-;/m1./s1 |
| InChIKey | OYFLAERUJMBARH-RFVHGSKJSA-N |
| XLogP | 5.11 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|