C30H34F2N4O6 — CID 168943023
3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline;4-(2-hydroxy-2-methylpropoxy)pyridine-3-carbaldehyde (PubChem CID 168943023) has the molecular formula C30H34F2N4O6 and a molecular weight of 584.62 g/mol. Its IUPAC name is 3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline;4-(2-hydroxy-2-methylpropoxy)pyridine-3-carbaldehyde.
| Compound Name | 3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline;4-(2-hydroxy-2-methylpropoxy)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 168943023 |
| Molecular Formula | C30H34F2N4O6 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | 3,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline;4-(2-hydroxy-2-methylpropoxy)pyridine-3-carbaldehyde |
| SMILES | CC(C)(O)COc1ccncc1C=O.CNCCOc1cc2nccc(Oc3c(F)cc(NC)cc3F)c2cc1OC |
| InChI | InChI=1S/C20H21F2N3O3.C10H13NO3/c1-23-6-7-27-19-11-16-13(10-18(19)26-3)17(4-5-25-16)28-20-14(21)8-12(24-2)9-15(20)22;1-10(2,13)7-14-9-3-4-11-5-8(9)6-12/h4-5,8-11,23-24H,6-7H2,1-3H3;3-6,13H,7H2,1-2H3 |
| InChIKey | PDSDXUWLPNJIDD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|