C19H19F2N3O3 — CID 168943014
2,3-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyaniline (PubChem CID 168943014) has the molecular formula C19H19F2N3O3 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2,3-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyaniline.
| Compound Name | 2,3-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 168943014 |
| Molecular Formula | C19H19F2N3O3 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2,3-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyaniline |
| SMILES | CNCCOc1cc2nccc(Oc3ccc(N)c(F)c3F)c2cc1OC |
| InChI | InChI=1S/C19H19F2N3O3/c1-23-7-8-26-17-10-13-11(9-16(17)25-2)14(5-6-24-13)27-15-4-3-12(22)18(20)19(15)21/h3-6,9-10,23H,7-8,22H2,1-2H3 |
| InChIKey | GFWJKVFHALVBSG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|