C27H27F3N4O5 — CID 168943045
2,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline;2-fluoro-4-methoxypyridine-3-carbaldehyde (PubChem CID 168943045) has the molecular formula C27H27F3N4O5 and a molecular weight of 544.53 g/mol. Its IUPAC name is 2,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline;2-fluoro-4-methoxypyridine-3-carbaldehyde.
| Compound Name | 2,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline;2-fluoro-4-methoxypyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 168943045 |
| Molecular Formula | C27H27F3N4O5 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | 2,5-difluoro-4-[6-methoxy-7-[2-(methylamino)ethoxy]quinolin-4-yl]oxy-N-methylaniline;2-fluoro-4-methoxypyridine-3-carbaldehyde |
| SMILES | CNCCOc1cc2nccc(Oc3cc(F)c(NC)cc3F)c2cc1OC.COc1ccnc(F)c1C=O |
| InChI | InChI=1S/C20H21F2N3O3.C7H6FNO2/c1-23-6-7-27-20-11-15-12(8-19(20)26-3)17(4-5-25-15)28-18-10-13(21)16(24-2)9-14(18)22;1-11-6-2-3-9-7(8)5(6)4-10/h4-5,8-11,23-24H,6-7H2,1-3H3;2-4H,1H3 |
| InChIKey | DCEFSFXRGIMJDD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|