C17H14F2N2O5S — CID 155099854
4-[2,5-difluoro-4-(sulfinoamino)phenoxy]-6,7-dimethoxyquinoline (PubChem CID 155099854) has the molecular formula C17H14F2N2O5S and a molecular weight of 396.37 g/mol. Its IUPAC name is 4-[2,5-difluoro-4-(sulfinoamino)phenoxy]-6,7-dimethoxyquinoline.
| Compound Name | 4-[2,5-difluoro-4-(sulfinoamino)phenoxy]-6,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 155099854 |
| Molecular Formula | C17H14F2N2O5S |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-[2,5-difluoro-4-(sulfinoamino)phenoxy]-6,7-dimethoxyquinoline |
| SMILES | COc1cc2nccc(Oc3cc(F)c(NS(=O)O)cc3F)c2cc1OC |
| InChI | InChI=1S/C17H14F2N2O5S/c1-24-16-5-9-12(8-17(16)25-2)20-4-3-14(9)26-15-7-10(18)13(6-11(15)19)21-27(22)23/h3-8,21H,1-2H3,(H,22,23) |
| InChIKey | JMLXKJIKETVUNB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|