C18H15FN2O4S — CID 166561964
[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]sulfinylmethanimine (PubChem CID 166561964) has the molecular formula C18H15FN2O4S and a molecular weight of 374.39 g/mol. Its IUPAC name is [4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]sulfinylmethanimine.
| Compound Name | [4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]sulfinylmethanimine |
|---|---|
| PubChem CID | 166561964 |
| Molecular Formula | C18H15FN2O4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]sulfinylmethanimine |
| SMILES | [H]/N=C/S(=O)c1ccc(Oc2ccnc3cc(OC)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C18H15FN2O4S/c1-23-17-8-12-14(9-18(17)24-2)21-6-5-15(12)25-16-4-3-11(7-13(16)19)26(22)10-20/h3-10,20H,1-2H3/b20-10+ |
| InChIKey | LEUVUPDHBHDRRM-KEBDBYFISA-N |
| XLogP | 3.90 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|