C18H12FN3O3 — CID 156569958
N-[4-(6-cyano-7-methoxyquinolin-4-yl)oxy-3-fluorophenyl]formamide (PubChem CID 156569958) has the molecular formula C18H12FN3O3 and a molecular weight of 337.31 g/mol. Its IUPAC name is N-[4-(6-cyano-7-methoxyquinolin-4-yl)oxy-3-fluorophenyl]formamide.
| Compound Name | N-[4-(6-cyano-7-methoxyquinolin-4-yl)oxy-3-fluorophenyl]formamide |
|---|---|
| PubChem CID | 156569958 |
| Molecular Formula | C18H12FN3O3 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[4-(6-cyano-7-methoxyquinolin-4-yl)oxy-3-fluorophenyl]formamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC=O)cc3F)c2cc1C#N |
| InChI | InChI=1S/C18H12FN3O3/c1-24-18-8-15-13(6-11(18)9-20)16(4-5-21-15)25-17-3-2-12(22-10-23)7-14(17)19/h2-8,10H,1H3,(H,22,23) |
| InChIKey | VHLOCJDTQZKWBG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|