C21H16FN3O3 — CID 141201268
4-(2-fluoro-4-pyrimidin-5-ylphenoxy)-6,7-dimethoxyquinoline (PubChem CID 141201268) has the molecular formula C21H16FN3O3 and a molecular weight of 377.38 g/mol. Its IUPAC name is 4-(2-fluoro-4-pyrimidin-5-ylphenoxy)-6,7-dimethoxyquinoline.
| Compound Name | 4-(2-fluoro-4-pyrimidin-5-ylphenoxy)-6,7-dimethoxyquinoline |
|---|---|
| PubChem CID | 141201268 |
| Molecular Formula | C21H16FN3O3 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-(2-fluoro-4-pyrimidin-5-ylphenoxy)-6,7-dimethoxyquinoline |
| SMILES | COc1cc2nccc(Oc3ccc(-c4cncnc4)cc3F)c2cc1OC |
| InChI | InChI=1S/C21H16FN3O3/c1-26-20-8-15-17(9-21(20)27-2)25-6-5-18(15)28-19-4-3-13(7-16(19)22)14-10-23-12-24-11-14/h3-12H,1-2H3 |
| InChIKey | FXZVDEVGJXONHD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |