C23H18FN3O4S2 — CID 58738934
N-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 58738934) has the molecular formula C23H18FN3O4S2 and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58738934 |
| Molecular Formula | C23H18FN3O4S2 |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | N-[[4-(6,7-dimethoxyquinolin-4-yl)oxy-2-fluorophenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)NC(=O)c4cccs4)c(F)c3)c2cc1OC |
| InChI | InChI=1S/C23H18FN3O4S2/c1-29-19-11-14-17(12-20(19)30-2)25-8-7-18(14)31-13-5-6-16(15(24)10-13)26-23(32)27-22(28)21-4-3-9-33-21/h3-12H,1-2H3,(H2,26,27,28,32) |
| InChIKey | AIWYWQIIRNCQDI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|