C27H26F2N4O4 — CID 174116867
(3-cyclopropyloxy-2-pyridinyl)-[3,5-difluoro-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyanilino]methanol (PubChem CID 174116867) has the molecular formula C27H26F2N4O4 and a molecular weight of 508.53 g/mol. Its IUPAC name is (3-cyclopropyloxy-2-pyridinyl)-[3,5-difluoro-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyanilino]methanol.
| Compound Name | (3-cyclopropyloxy-2-pyridinyl)-[3,5-difluoro-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyanilino]methanol |
|---|---|
| PubChem CID | 174116867 |
| Molecular Formula | C27H26F2N4O4 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (3-cyclopropyloxy-2-pyridinyl)-[3,5-difluoro-4-[7-[2-(methylamino)ethoxy]quinolin-4-yl]oxyanilino]methanol |
| SMILES | CNCCOc1ccc2c(Oc3c(F)cc(NC(O)c4ncccc4OC4CC4)cc3F)ccnc2c1 |
| InChI | InChI=1S/C27H26F2N4O4/c1-30-11-12-35-18-6-7-19-22(15-18)31-10-8-23(19)37-26-20(28)13-16(14-21(26)29)33-27(34)25-24(3-2-9-32-25)36-17-4-5-17/h2-3,6-10,13-15,17,27,30,33-34H,4-5,11-12H2,1H3 |
| InChIKey | JMBOFQBBVHMWJK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|